C11H8BrN3O — CID 151643900
N-(6-bromoquinazolin-4-yl)prop-2-enamide (PubChem CID 151643900) has the molecular formula C11H8BrN3O and a molecular weight of 278.11 g/mol. Its IUPAC name is N-(6-bromoquinazolin-4-yl)prop-2-enamide.
| Compound Name | N-(6-bromoquinazolin-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 151643900 |
| Molecular Formula | C11H8BrN3O |
| Molecular Weight | 278.11 g/mol |
| Exact Mass | 276.99 |
| IUPAC Name | N-(6-bromoquinazolin-4-yl)prop-2-enamide |
| SMILES | C=CC(=O)Nc1ncnc2ccc(Br)cc12 |
| InChI | InChI=1S/C11H8BrN3O/c1-2-10(16)15-11-8-5-7(12)3-4-9(8)13-6-14-11/h2-6H,1H2,(H,13,14,15,16) |
| InChIKey | QTCKTNIGDFMJBC-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.11 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|