C9H13NO2 — CID 151645109
1-methyl-2,3,8,8a-tetrahydro-1H-indolizine-5,7-dione (PubChem CID 151645109) has the molecular formula C9H13NO2 and a molecular weight of 167.21 g/mol. Its IUPAC name is 1-methyl-2,3,8,8a-tetrahydro-1H-indolizine-5,7-dione.
| Compound Name | 1-methyl-2,3,8,8a-tetrahydro-1H-indolizine-5,7-dione |
|---|---|
| PubChem CID | 151645109 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | 1-methyl-2,3,8,8a-tetrahydro-1H-indolizine-5,7-dione |
| SMILES | CC1CCN2C(=O)CC(=O)CC12 |
| InChI | InChI=1S/C9H13NO2/c1-6-2-3-10-8(6)4-7(11)5-9(10)12/h6,8H,2-5H2,1H3 |
| InChIKey | QTISBYRXTDGMDA-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|