C9H15N2OS+ — CID 15165929
1-(1,3,4-trimethylimidazol-1-ium-2-yl)sulfanylpropan-2-one (PubChem CID 15165929) has the molecular formula C9H15N2OS+ and a molecular weight of 199.30 g/mol. Its IUPAC name is 1-(1,3,4-trimethylimidazol-1-ium-2-yl)sulfanylpropan-2-one.
| Compound Name | 1-(1,3,4-trimethylimidazol-1-ium-2-yl)sulfanylpropan-2-one |
|---|---|
| PubChem CID | 15165929 |
| Molecular Formula | C9H15N2OS+ |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.09 |
| IUPAC Name | 1-(1,3,4-trimethylimidazol-1-ium-2-yl)sulfanylpropan-2-one |
| SMILES | CC(=O)CSc1n(C)c(C)c[n+]1C |
| InChI | InChI=1S/C9H15N2OS/c1-7-5-10(3)9(11(7)4)13-6-8(2)12/h5H,6H2,1-4H3/q+1 |
| InChIKey | SMPAOBUSKATCNG-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 25.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|