C27H24ClN3O5 — CID 151667750
[1-[(4-chlorophenyl)methyl]-4-[2-[(2-methoxy-4-pyridinyl)amino]-2-oxoacetyl]-2,3-dimethylindol-5-yl] acetate (PubChem CID 151667750) has the molecular formula C27H24ClN3O5 and a molecular weight of 505.96 g/mol. Its IUPAC name is [1-[(4-chlorophenyl)methyl]-4-[2-[(2-methoxy-4-pyridinyl)amino]-2-oxoacetyl]-2,3-dimethylindol-5-yl] acetate.
| Compound Name | [1-[(4-chlorophenyl)methyl]-4-[2-[(2-methoxy-4-pyridinyl)amino]-2-oxoacetyl]-2,3-dimethylindol-5-yl] acetate |
|---|---|
| PubChem CID | 151667750 |
| Molecular Formula | C27H24ClN3O5 |
| Molecular Weight | 505.96 g/mol |
| Exact Mass | 505.14 |
| IUPAC Name | [1-[(4-chlorophenyl)methyl]-4-[2-[(2-methoxy-4-pyridinyl)amino]-2-oxoacetyl]-2,3-dimethylindol-5-yl] acetate |
| SMILES | COc1cc(NC(=O)C(=O)c2c(OC(C)=O)ccc3c2c(C)c(C)n3Cc2ccc(Cl)cc2)ccn1 |
| InChI | InChI=1S/C27H24ClN3O5/c1-15-16(2)31(14-18-5-7-19(28)8-6-18)21-9-10-22(36-17(3)32)25(24(15)21)26(33)27(34)30-20-11-12-29-23(13-20)35-4/h5-13H,14H2,1-4H3,(H,29,30,34) |
| InChIKey | QXWSPAANCZUJBL-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.96 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|