C25H20ClN3O5 — CID 57386189
1-[(4-chlorophenyl)methyl]-3-[2-[(2-methoxy-4-pyridinyl)amino]-2-oxoacetyl]-2-methylindole-5-carboxylic acid (PubChem CID 57386189) has the molecular formula C25H20ClN3O5 and a molecular weight of 477.90 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-3-[2-[(2-methoxy-4-pyridinyl)amino]-2-oxoacetyl]-2-methylindole-5-carboxylic acid.
| Compound Name | 1-[(4-chlorophenyl)methyl]-3-[2-[(2-methoxy-4-pyridinyl)amino]-2-oxoacetyl]-2-methylindole-5-carboxylic acid |
|---|---|
| PubChem CID | 57386189 |
| Molecular Formula | C25H20ClN3O5 |
| Molecular Weight | 477.90 g/mol |
| Exact Mass | 477.11 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-3-[2-[(2-methoxy-4-pyridinyl)amino]-2-oxoacetyl]-2-methylindole-5-carboxylic acid |
| SMILES | COc1cc(NC(=O)C(=O)c2c(C)n(Cc3ccc(Cl)cc3)c3ccc(C(=O)O)cc23)ccn1 |
| InChI | InChI=1S/C25H20ClN3O5/c1-14-22(23(30)24(31)28-18-9-10-27-21(12-18)34-2)19-11-16(25(32)33)5-8-20(19)29(14)13-15-3-6-17(26)7-4-15/h3-12H,13H2,1-2H3,(H,32,33)(H,27,28,31) |
| InChIKey | FTGIZBFEKFYKPB-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.90 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|