C24H17Cl3N2O2 — CID 53307127
2-[5-chloro-1-[(4-chlorophenyl)methyl]-2-methylindol-3-yl]-N-(3-chlorophenyl)-2-oxoacetamide (PubChem CID 53307127) has the molecular formula C24H17Cl3N2O2 and a molecular weight of 471.77 g/mol. Its IUPAC name is 2-[5-chloro-1-[(4-chlorophenyl)methyl]-2-methylindol-3-yl]-N-(3-chlorophenyl)-2-oxoacetamide.
| Compound Name | 2-[5-chloro-1-[(4-chlorophenyl)methyl]-2-methylindol-3-yl]-N-(3-chlorophenyl)-2-oxoacetamide |
|---|---|
| PubChem CID | 53307127 |
| Molecular Formula | C24H17Cl3N2O2 |
| Molecular Weight | 471.77 g/mol |
| Exact Mass | 470.04 |
| IUPAC Name | 2-[5-chloro-1-[(4-chlorophenyl)methyl]-2-methylindol-3-yl]-N-(3-chlorophenyl)-2-oxoacetamide |
| SMILES | Cc1c(C(=O)C(=O)Nc2cccc(Cl)c2)c2cc(Cl)ccc2n1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H17Cl3N2O2/c1-14-22(23(30)24(31)28-19-4-2-3-17(26)11-19)20-12-18(27)9-10-21(20)29(14)13-15-5-7-16(25)8-6-15/h2-12H,13H2,1H3,(H,28,31) |
| InChIKey | SZTVADARXQWXTB-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.77 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|