C22H17ClN2O4 — CID 23514049
2-[1-[(4-chlorophenyl)methyl]-2-methylindol-3-yl]-2-oxo-N-(5-oxo-2H-furan-3-yl)acetamide (PubChem CID 23514049) has the molecular formula C22H17ClN2O4 and a molecular weight of 408.84 g/mol. Its IUPAC name is 2-[1-[(4-chlorophenyl)methyl]-2-methylindol-3-yl]-2-oxo-N-(5-oxo-2H-furan-3-yl)acetamide.
| Compound Name | 2-[1-[(4-chlorophenyl)methyl]-2-methylindol-3-yl]-2-oxo-N-(5-oxo-2H-furan-3-yl)acetamide |
|---|---|
| PubChem CID | 23514049 |
| Molecular Formula | C22H17ClN2O4 |
| Molecular Weight | 408.84 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | 2-[1-[(4-chlorophenyl)methyl]-2-methylindol-3-yl]-2-oxo-N-(5-oxo-2H-furan-3-yl)acetamide |
| SMILES | Cc1c(C(=O)C(=O)NC2=CC(=O)OC2)c2ccccc2n1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H17ClN2O4/c1-13-20(21(27)22(28)24-16-10-19(26)29-12-16)17-4-2-3-5-18(17)25(13)11-14-6-8-15(23)9-7-14/h2-10H,11-12H2,1H3,(H,24,28) |
| InChIKey | DBOKJOKKNGRPTL-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.84 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|