C24H20N2O6 — CID 91036139
ethyl 4-[[4-[2-oxo-2-[(5-oxo-2H-furan-3-yl)amino]acetyl]indol-1-yl]methyl]benzoate (PubChem CID 91036139) has the molecular formula C24H20N2O6 and a molecular weight of 432.43 g/mol. Its IUPAC name is ethyl 4-[[4-[2-oxo-2-[(5-oxo-2H-furan-3-yl)amino]acetyl]indol-1-yl]methyl]benzoate.
| Compound Name | ethyl 4-[[4-[2-oxo-2-[(5-oxo-2H-furan-3-yl)amino]acetyl]indol-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 91036139 |
| Molecular Formula | C24H20N2O6 |
| Molecular Weight | 432.43 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | ethyl 4-[[4-[2-oxo-2-[(5-oxo-2H-furan-3-yl)amino]acetyl]indol-1-yl]methyl]benzoate |
| SMILES | CCOC(=O)c1ccc(Cn2ccc3c(C(=O)C(=O)NC4=CC(=O)OC4)cccc32)cc1 |
| InChI | InChI=1S/C24H20N2O6/c1-2-31-24(30)16-8-6-15(7-9-16)13-26-11-10-18-19(4-3-5-20(18)26)22(28)23(29)25-17-12-21(27)32-14-17/h3-12H,2,13-14H2,1H3,(H,25,29) |
| InChIKey | DXXPACRDGLEXFO-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.43 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|