C21H14F2N2O4 — CID 23514002
2-[1-[(3,5-difluorophenyl)methyl]indol-3-yl]-2-oxo-N-(5-oxo-2H-furan-3-yl)acetamide (PubChem CID 23514002) has the molecular formula C21H14F2N2O4 and a molecular weight of 396.35 g/mol. Its IUPAC name is 2-[1-[(3,5-difluorophenyl)methyl]indol-3-yl]-2-oxo-N-(5-oxo-2H-furan-3-yl)acetamide.
| Compound Name | 2-[1-[(3,5-difluorophenyl)methyl]indol-3-yl]-2-oxo-N-(5-oxo-2H-furan-3-yl)acetamide |
|---|---|
| PubChem CID | 23514002 |
| Molecular Formula | C21H14F2N2O4 |
| Molecular Weight | 396.35 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | 2-[1-[(3,5-difluorophenyl)methyl]indol-3-yl]-2-oxo-N-(5-oxo-2H-furan-3-yl)acetamide |
| SMILES | O=C1C=C(NC(=O)C(=O)c2cn(Cc3cc(F)cc(F)c3)c3ccccc23)CO1 |
| InChI | InChI=1S/C21H14F2N2O4/c22-13-5-12(6-14(23)7-13)9-25-10-17(16-3-1-2-4-18(16)25)20(27)21(28)24-15-8-19(26)29-11-15/h1-8,10H,9,11H2,(H,24,28) |
| InChIKey | VVGZMIXGJPDCCS-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.35 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|