C24H21ClN4O5 — CID 23514103
N-(2-aminoethyl)-1-[(4-chlorophenyl)methyl]-3-[2-oxo-2-[(5-oxo-2H-furan-3-yl)amino]acetyl]indole-4-carboxamide (PubChem CID 23514103) has the molecular formula C24H21ClN4O5 and a molecular weight of 480.91 g/mol. Its IUPAC name is N-(2-aminoethyl)-1-[(4-chlorophenyl)methyl]-3-[2-oxo-2-[(5-oxo-2H-furan-3-yl)amino]acetyl]indole-4-carboxamide.
| Compound Name | N-(2-aminoethyl)-1-[(4-chlorophenyl)methyl]-3-[2-oxo-2-[(5-oxo-2H-furan-3-yl)amino]acetyl]indole-4-carboxamide |
|---|---|
| PubChem CID | 23514103 |
| Molecular Formula | C24H21ClN4O5 |
| Molecular Weight | 480.91 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | N-(2-aminoethyl)-1-[(4-chlorophenyl)methyl]-3-[2-oxo-2-[(5-oxo-2H-furan-3-yl)amino]acetyl]indole-4-carboxamide |
| SMILES | NCCNC(=O)c1cccc2c1c(C(=O)C(=O)NC1=CC(=O)OC1)cn2Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H21ClN4O5/c25-15-6-4-14(5-7-15)11-29-12-18(22(31)24(33)28-16-10-20(30)34-13-16)21-17(2-1-3-19(21)29)23(32)27-9-8-26/h1-7,10,12H,8-9,11,13,26H2,(H,27,32)(H,28,33) |
| InChIKey | INIAPRCJSQNBAO-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 132.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.91 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|