C23H19ClN2O4 — CID 23514108
2-[1-[(4-chlorophenyl)methyl]-2,5-dimethylindol-3-yl]-2-oxo-N-(5-oxo-2H-furan-3-yl)acetamide (PubChem CID 23514108) has the molecular formula C23H19ClN2O4 and a molecular weight of 422.87 g/mol. Its IUPAC name is 2-[1-[(4-chlorophenyl)methyl]-2,5-dimethylindol-3-yl]-2-oxo-N-(5-oxo-2H-furan-3-yl)acetamide.
| Compound Name | 2-[1-[(4-chlorophenyl)methyl]-2,5-dimethylindol-3-yl]-2-oxo-N-(5-oxo-2H-furan-3-yl)acetamide |
|---|---|
| PubChem CID | 23514108 |
| Molecular Formula | C23H19ClN2O4 |
| Molecular Weight | 422.87 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | 2-[1-[(4-chlorophenyl)methyl]-2,5-dimethylindol-3-yl]-2-oxo-N-(5-oxo-2H-furan-3-yl)acetamide |
| SMILES | Cc1ccc2c(c1)c(C(=O)C(=O)NC1=CC(=O)OC1)c(C)n2Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H19ClN2O4/c1-13-3-8-19-18(9-13)21(22(28)23(29)25-17-10-20(27)30-12-17)14(2)26(19)11-15-4-6-16(24)7-5-15/h3-10H,11-12H2,1-2H3,(H,25,29) |
| InChIKey | VKIMFQKWOMXYES-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.87 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|