C23H16ClF3N4O2 — CID 68912713
2-[1-[(4-chlorophenyl)methyl]-5-methyl-2-(trifluoromethyl)indol-3-yl]-2-oxo-N-pyrimidin-4-ylacetamide (PubChem CID 68912713) has the molecular formula C23H16ClF3N4O2 and a molecular weight of 472.85 g/mol. Its IUPAC name is 2-[1-[(4-chlorophenyl)methyl]-5-methyl-2-(trifluoromethyl)indol-3-yl]-2-oxo-N-pyrimidin-4-ylacetamide.
| Compound Name | 2-[1-[(4-chlorophenyl)methyl]-5-methyl-2-(trifluoromethyl)indol-3-yl]-2-oxo-N-pyrimidin-4-ylacetamide |
|---|---|
| PubChem CID | 68912713 |
| Molecular Formula | C23H16ClF3N4O2 |
| Molecular Weight | 472.85 g/mol |
| Exact Mass | 472.09 |
| IUPAC Name | 2-[1-[(4-chlorophenyl)methyl]-5-methyl-2-(trifluoromethyl)indol-3-yl]-2-oxo-N-pyrimidin-4-ylacetamide |
| SMILES | Cc1ccc2c(c1)c(C(=O)C(=O)Nc1ccncn1)c(C(F)(F)F)n2Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H16ClF3N4O2/c1-13-2-7-17-16(10-13)19(20(32)22(33)30-18-8-9-28-12-29-18)21(23(25,26)27)31(17)11-14-3-5-15(24)6-4-14/h2-10,12H,11H2,1H3,(H,28,29,30,33) |
| InChIKey | HFIODUYPSWZUOH-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.85 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|