C24H15Cl3F3N3O2 — CID 87464777
N-(2-chloro-4-pyridinyl)-2-[1-[(2,4-dichlorophenyl)methyl]-5-methyl-2-(trifluoromethyl)indol-3-yl]-2-oxoacetamide (PubChem CID 87464777) has the molecular formula C24H15Cl3F3N3O2 and a molecular weight of 540.76 g/mol. Its IUPAC name is N-(2-chloro-4-pyridinyl)-2-[1-[(2,4-dichlorophenyl)methyl]-5-methyl-2-(trifluoromethyl)indol-3-yl]-2-oxoacetamide.
| Compound Name | N-(2-chloro-4-pyridinyl)-2-[1-[(2,4-dichlorophenyl)methyl]-5-methyl-2-(trifluoromethyl)indol-3-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 87464777 |
| Molecular Formula | C24H15Cl3F3N3O2 |
| Molecular Weight | 540.76 g/mol |
| Exact Mass | 539.02 |
| IUPAC Name | N-(2-chloro-4-pyridinyl)-2-[1-[(2,4-dichlorophenyl)methyl]-5-methyl-2-(trifluoromethyl)indol-3-yl]-2-oxoacetamide |
| SMILES | Cc1ccc2c(c1)c(C(=O)C(=O)Nc1ccnc(Cl)c1)c(C(F)(F)F)n2Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C24H15Cl3F3N3O2/c1-12-2-5-18-16(8-12)20(21(34)23(35)32-15-6-7-31-19(27)10-15)22(24(28,29)30)33(18)11-13-3-4-14(25)9-17(13)26/h2-10H,11H2,1H3,(H,31,32,35) |
| InChIKey | WHAQCIKILHSINL-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.76 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|