C24H14Cl3F3N2O2 — CID 87464361
N-(3-chlorophenyl)-2-[1-[(2,4-dichlorophenyl)methyl]-2-(trifluoromethyl)indol-3-yl]-2-oxoacetamide (PubChem CID 87464361) has the molecular formula C24H14Cl3F3N2O2 and a molecular weight of 525.74 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-[1-[(2,4-dichlorophenyl)methyl]-2-(trifluoromethyl)indol-3-yl]-2-oxoacetamide.
| Compound Name | N-(3-chlorophenyl)-2-[1-[(2,4-dichlorophenyl)methyl]-2-(trifluoromethyl)indol-3-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 87464361 |
| Molecular Formula | C24H14Cl3F3N2O2 |
| Molecular Weight | 525.74 g/mol |
| Exact Mass | 524.01 |
| IUPAC Name | N-(3-chlorophenyl)-2-[1-[(2,4-dichlorophenyl)methyl]-2-(trifluoromethyl)indol-3-yl]-2-oxoacetamide |
| SMILES | O=C(Nc1cccc(Cl)c1)C(=O)c1c(C(F)(F)F)n(Cc2ccc(Cl)cc2Cl)c2ccccc12 |
| InChI | InChI=1S/C24H14Cl3F3N2O2/c25-14-4-3-5-16(10-14)31-23(34)21(33)20-17-6-1-2-7-19(17)32(22(20)24(28,29)30)12-13-8-9-15(26)11-18(13)27/h1-11H,12H2,(H,31,34) |
| InChIKey | JSVBGNNFEAIQCA-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.74 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|