C23H14Cl4N2O2 — CID 68911621
N-(3-chlorophenyl)-2-[2,5-dichloro-1-[(4-chlorophenyl)methyl]indol-3-yl]-2-oxoacetamide (PubChem CID 68911621) has the molecular formula C23H14Cl4N2O2 and a molecular weight of 492.19 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-[2,5-dichloro-1-[(4-chlorophenyl)methyl]indol-3-yl]-2-oxoacetamide.
| Compound Name | N-(3-chlorophenyl)-2-[2,5-dichloro-1-[(4-chlorophenyl)methyl]indol-3-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 68911621 |
| Molecular Formula | C23H14Cl4N2O2 |
| Molecular Weight | 492.19 g/mol |
| Exact Mass | 489.98 |
| IUPAC Name | N-(3-chlorophenyl)-2-[2,5-dichloro-1-[(4-chlorophenyl)methyl]indol-3-yl]-2-oxoacetamide |
| SMILES | O=C(Nc1cccc(Cl)c1)C(=O)c1c(Cl)n(Cc2ccc(Cl)cc2)c2ccc(Cl)cc12 |
| InChI | InChI=1S/C23H14Cl4N2O2/c24-14-6-4-13(5-7-14)12-29-19-9-8-16(26)11-18(19)20(22(29)27)21(30)23(31)28-17-3-1-2-15(25)10-17/h1-11H,12H2,(H,28,31) |
| InChIKey | DGJSGPGRXKPTDG-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.19 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|