C23H17Cl2N3O3 — CID 53308195
2-[2-chloro-1-[(4-chlorophenyl)methyl]-5-methoxyindol-3-yl]-2-oxo-N-pyridin-3-ylacetamide (PubChem CID 53308195) has the molecular formula C23H17Cl2N3O3 and a molecular weight of 454.31 g/mol. Its IUPAC name is 2-[2-chloro-1-[(4-chlorophenyl)methyl]-5-methoxyindol-3-yl]-2-oxo-N-pyridin-3-ylacetamide.
| Compound Name | 2-[2-chloro-1-[(4-chlorophenyl)methyl]-5-methoxyindol-3-yl]-2-oxo-N-pyridin-3-ylacetamide |
|---|---|
| PubChem CID | 53308195 |
| Molecular Formula | C23H17Cl2N3O3 |
| Molecular Weight | 454.31 g/mol |
| Exact Mass | 453.06 |
| IUPAC Name | 2-[2-chloro-1-[(4-chlorophenyl)methyl]-5-methoxyindol-3-yl]-2-oxo-N-pyridin-3-ylacetamide |
| SMILES | COc1ccc2c(c1)c(C(=O)C(=O)Nc1cccnc1)c(Cl)n2Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H17Cl2N3O3/c1-31-17-8-9-19-18(11-17)20(21(29)23(30)27-16-3-2-10-26-12-16)22(25)28(19)13-14-4-6-15(24)7-5-14/h2-12H,13H2,1H3,(H,27,30) |
| InChIKey | WBSWSFHVTHUMRY-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.31 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|