C25H19Cl3N2O4 — CID 68908072
2-[2-chloro-1-[(2,4-dichlorophenyl)methyl]-5-methoxyindol-3-yl]-N-(4-methoxyphenyl)-2-oxoacetamide (PubChem CID 68908072) has the molecular formula C25H19Cl3N2O4 and a molecular weight of 517.80 g/mol. Its IUPAC name is 2-[2-chloro-1-[(2,4-dichlorophenyl)methyl]-5-methoxyindol-3-yl]-N-(4-methoxyphenyl)-2-oxoacetamide.
| Compound Name | 2-[2-chloro-1-[(2,4-dichlorophenyl)methyl]-5-methoxyindol-3-yl]-N-(4-methoxyphenyl)-2-oxoacetamide |
|---|---|
| PubChem CID | 68908072 |
| Molecular Formula | C25H19Cl3N2O4 |
| Molecular Weight | 517.80 g/mol |
| Exact Mass | 516.04 |
| IUPAC Name | 2-[2-chloro-1-[(2,4-dichlorophenyl)methyl]-5-methoxyindol-3-yl]-N-(4-methoxyphenyl)-2-oxoacetamide |
| SMILES | COc1ccc(NC(=O)C(=O)c2c(Cl)n(Cc3ccc(Cl)cc3Cl)c3ccc(OC)cc23)cc1 |
| InChI | InChI=1S/C25H19Cl3N2O4/c1-33-17-7-5-16(6-8-17)29-25(32)23(31)22-19-12-18(34-2)9-10-21(19)30(24(22)28)13-14-3-4-15(26)11-20(14)27/h3-12H,13H2,1-2H3,(H,29,32) |
| InChIKey | AZWUEUUDXQAWMA-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.80 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|