C28H27ClN4O3 — CID 57405859
2-[1-[(4-chlorophenyl)methyl]-2-methyl-5-pyrrolidin-1-ylindol-3-yl]-N-(2-methoxy-4-pyridinyl)-2-oxoacetamide (PubChem CID 57405859) has the molecular formula C28H27ClN4O3 and a molecular weight of 503.00 g/mol. Its IUPAC name is 2-[1-[(4-chlorophenyl)methyl]-2-methyl-5-pyrrolidin-1-ylindol-3-yl]-N-(2-methoxy-4-pyridinyl)-2-oxoacetamide.
| Compound Name | 2-[1-[(4-chlorophenyl)methyl]-2-methyl-5-pyrrolidin-1-ylindol-3-yl]-N-(2-methoxy-4-pyridinyl)-2-oxoacetamide |
|---|---|
| PubChem CID | 57405859 |
| Molecular Formula | C28H27ClN4O3 |
| Molecular Weight | 503.00 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | 2-[1-[(4-chlorophenyl)methyl]-2-methyl-5-pyrrolidin-1-ylindol-3-yl]-N-(2-methoxy-4-pyridinyl)-2-oxoacetamide |
| SMILES | COc1cc(NC(=O)C(=O)c2c(C)n(Cc3ccc(Cl)cc3)c3ccc(N4CCCC4)cc23)ccn1 |
| InChI | InChI=1S/C28H27ClN4O3/c1-18-26(27(34)28(35)31-21-11-12-30-25(15-21)36-2)23-16-22(32-13-3-4-14-32)9-10-24(23)33(18)17-19-5-7-20(29)8-6-19/h5-12,15-16H,3-4,13-14,17H2,1-2H3,(H,30,31,35) |
| InChIKey | NLNKMWQDUPICEE-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.00 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|