C11H20I2O — CID 151670843
4,6-diiodo-4,6-dimethylnonan-5-one (PubChem CID 151670843) has the molecular formula C11H20I2O and a molecular weight of 422.09 g/mol. Its IUPAC name is 4,6-diiodo-4,6-dimethylnonan-5-one.
| Compound Name | 4,6-diiodo-4,6-dimethylnonan-5-one |
|---|---|
| PubChem CID | 151670843 |
| Molecular Formula | C11H20I2O |
| Molecular Weight | 422.09 g/mol |
| Exact Mass | 421.96 |
| IUPAC Name | 4,6-diiodo-4,6-dimethylnonan-5-one |
| SMILES | CCCC(C)(I)C(=O)C(C)(I)CCC |
| InChI | InChI=1S/C11H20I2O/c1-5-7-10(3,12)9(14)11(4,13)8-6-2/h5-8H2,1-4H3 |
| InChIKey | QYNBBXODFMUMLL-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.09 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|