C34H54N2O2 — CID 151713075
[(8R,9S,10S,13S,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-16-yl] 3,5-diaminobenzoate (PubChem CID 151713075) has the molecular formula C34H54N2O2 and a molecular weight of 522.82 g/mol. Its IUPAC name is [(8R,9S,10S,13S,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-16-yl] 3,5-diaminobenzoate.
| Compound Name | [(8R,9S,10S,13S,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-16-yl] 3,5-diaminobenzoate |
|---|---|
| PubChem CID | 151713075 |
| Molecular Formula | C34H54N2O2 |
| Molecular Weight | 522.82 g/mol |
| Exact Mass | 522.42 |
| IUPAC Name | [(8R,9S,10S,13S,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-16-yl] 3,5-diaminobenzoate |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1C(OC(=O)c2cc(N)cc(N)c2)C[C@H]2[C@@H]3CCC4CCCC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C34H54N2O2/c1-21(2)9-8-10-22(3)31-30(38-32(37)23-17-25(35)19-26(36)18-23)20-29-27-13-12-24-11-6-7-15-33(24,4)28(27)14-16-34(29,31)5/h17-19,21-22,24,27-31H,6-16,20,35-36H2,1-5H3/t22-,24?,27-,28+,29+,30?,31+,33+,34+/m1/s1 |
| InChIKey | RGYRPBBHPCFIDY-TWLBPOEASA-N |
| XLogP | 8.50 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.82 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|