C34H52OS — CID 154108719
O-[(8R,9S,10S,13S,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-16-yl] benzenecarbothioate (PubChem CID 154108719) has the molecular formula C34H52OS and a molecular weight of 508.86 g/mol. Its IUPAC name is O-[(8R,9S,10S,13S,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-16-yl] benzenecarbothioate.
| Compound Name | O-[(8R,9S,10S,13S,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-16-yl] benzenecarbothioate |
|---|---|
| PubChem CID | 154108719 |
| Molecular Formula | C34H52OS |
| Molecular Weight | 508.86 g/mol |
| Exact Mass | 508.37 |
| IUPAC Name | O-[(8R,9S,10S,13S,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-16-yl] benzenecarbothioate |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1C(OC(=S)c2ccccc2)C[C@H]2[C@@H]3CCC4CCCC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C34H52OS/c1-23(2)12-11-13-24(3)31-30(35-32(36)25-14-7-6-8-15-25)22-29-27-18-17-26-16-9-10-20-33(26,4)28(27)19-21-34(29,31)5/h6-8,14-15,23-24,26-31H,9-13,16-22H2,1-5H3/t24-,26?,27-,28+,29+,30?,31+,33+,34+/m1/s1 |
| InChIKey | VHMDHRVANRPAKI-QYPYMOHYSA-N |
| XLogP | 9.87 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.86 |
| LogP ≤ 5 | 9.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|