C33H53O4P — CID 172682569
[(8R,9S,10S,13S,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-16-phenyl-1,2,3,4,5,6,7,8,9,11,12,14,15,17-tetradecahydrocyclopenta[a]phenanthren-16-yl] dihydrogen phosphate (PubChem CID 172682569) has the molecular formula C33H53O4P and a molecular weight of 544.76 g/mol. Its IUPAC name is [(8R,9S,10S,13S,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-16-phenyl-1,2,3,4,5,6,7,8,9,11,12,14,15,17-tetradecahydrocyclopenta[a]phenanthren-16-yl] dihydrogen phosphate.
| Compound Name | [(8R,9S,10S,13S,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-16-phenyl-1,2,3,4,5,6,7,8,9,11,12,14,15,17-tetradecahydrocyclopenta[a]phenanthren-16-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 172682569 |
| Molecular Formula | C33H53O4P |
| Molecular Weight | 544.76 g/mol |
| Exact Mass | 544.37 |
| IUPAC Name | [(8R,9S,10S,13S,14S,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-16-phenyl-1,2,3,4,5,6,7,8,9,11,12,14,15,17-tetradecahydrocyclopenta[a]phenanthren-16-yl] dihydrogen phosphate |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1C(OP(=O)(O)O)(c2ccccc2)C[C@H]2[C@@H]3CCC4CCCC[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C33H53O4P/c1-23(2)12-11-13-24(3)30-32(5)21-19-28-27(18-17-25-14-9-10-20-31(25,28)4)29(32)22-33(30,37-38(34,35)36)26-15-7-6-8-16-26/h6-8,15-16,23-25,27-30H,9-14,17-22H2,1-5H3,(H2,34,35,36)/t24-,25?,27-,28+,29+,30-,31+,32+,33?/m1/s1 |
| InChIKey | APIFDCMCNFUXRB-JQAUYYCQSA-N |
| XLogP | 9.11 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.76 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|