C31H46O2 — CID 174877523
(8R,9S,10S,13S,14S,17R)-10,13-dimethyl-17-[(2R)-5-phenylmethoxypentan-2-yl]-1,2,3,4,5,6,7,8,9,11,12,14,15,17-tetradecahydrocyclopenta[a]phenanthren-16-one (PubChem CID 174877523) has the molecular formula C31H46O2 and a molecular weight of 450.71 g/mol. Its IUPAC name is (8R,9S,10S,13S,14S,17R)-10,13-dimethyl-17-[(2R)-5-phenylmethoxypentan-2-yl]-1,2,3,4,5,6,7,8,9,11,12,14,15,17-tetradecahydrocyclopenta[a]phenanthren-16-one.
| Compound Name | (8R,9S,10S,13S,14S,17R)-10,13-dimethyl-17-[(2R)-5-phenylmethoxypentan-2-yl]-1,2,3,4,5,6,7,8,9,11,12,14,15,17-tetradecahydrocyclopenta[a]phenanthren-16-one |
|---|---|
| PubChem CID | 174877523 |
| Molecular Formula | C31H46O2 |
| Molecular Weight | 450.71 g/mol |
| Exact Mass | 450.35 |
| IUPAC Name | (8R,9S,10S,13S,14S,17R)-10,13-dimethyl-17-[(2R)-5-phenylmethoxypentan-2-yl]-1,2,3,4,5,6,7,8,9,11,12,14,15,17-tetradecahydrocyclopenta[a]phenanthren-16-one |
| SMILES | C[C@H](CCCOCc1ccccc1)[C@H]1C(=O)C[C@H]2[C@@H]3CCC4CCCC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C31H46O2/c1-22(10-9-19-33-21-23-11-5-4-6-12-23)29-28(32)20-27-25-15-14-24-13-7-8-17-30(24,2)26(25)16-18-31(27,29)3/h4-6,11-12,22,24-27,29H,7-10,13-21H2,1-3H3/t22-,24?,25-,26+,27+,29+,30+,31+/m1/s1 |
| InChIKey | IXQOOVWQKSGWFZ-MTJZHIOQSA-N |
| XLogP | 7.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.71 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|