C27H46O4 — CID 91016520
(2S)-2-[(8R,9S,10S,13S,14S,17R)-16,16-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-6-methylheptanoic acid (PubChem CID 91016520) has the molecular formula C27H46O4 and a molecular weight of 434.66 g/mol. Its IUPAC name is (2S)-2-[(8R,9S,10S,13S,14S,17R)-16,16-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-6-methylheptanoic acid.
| Compound Name | (2S)-2-[(8R,9S,10S,13S,14S,17R)-16,16-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-6-methylheptanoic acid |
|---|---|
| PubChem CID | 91016520 |
| Molecular Formula | C27H46O4 |
| Molecular Weight | 434.66 g/mol |
| Exact Mass | 434.34 |
| IUPAC Name | (2S)-2-[(8R,9S,10S,13S,14S,17R)-16,16-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]-6-methylheptanoic acid |
| SMILES | CC(C)CCC[C@H](C(=O)O)[C@H]1C(O)(O)C[C@H]2[C@@H]3CCC4CCCC[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C27H46O4/c1-17(2)8-7-10-20(24(28)29)23-26(4)15-13-21-19(22(26)16-27(23,30)31)12-11-18-9-5-6-14-25(18,21)3/h17-23,30-31H,5-16H2,1-4H3,(H,28,29)/t18?,19-,20+,21+,22+,23-,25+,26+/m1/s1 |
| InChIKey | HRFOQBXCCNCCST-OIFAMGEISA-N |
| XLogP | 5.85 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.66 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|