About 5,7-dichloro-2,3-dihydroindol-1-amine
5,7-dichloro-2,3-dihydroindol-1-amine (PubChem CID 151713616) has the molecular formula C8H8Cl2N2
and a molecular weight of 203.07 g/mol. Its IUPAC name is 5,7-dichloro-2,3-dihydroindol-1-amine.
Molecular Properties
| Compound Name | 5,7-dichloro-2,3-dihydroindol-1-amine |
| PubChem CID | 151713616 |
| Molecular Formula | C8H8Cl2N2 |
| Molecular Weight | 203.07 g/mol |
| Exact Mass | 202.01 |
| IUPAC Name | 5,7-dichloro-2,3-dihydroindol-1-amine |
| SMILES | NN1CCc2cc(Cl)cc(Cl)c21 |
| InChI | InChI=1S/C8H8Cl2N2/c9-6-3-5-1-2-12(11)8(5)7(10)4-6/h3-4H,1-2,11H2 |
| InChIKey | RHBLKVNLVZTHNP-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.07 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze 5,7-dichloro-2,3-dihydroindol-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dichloro-2,3-dihydroindol-1-amine?
The IUPAC name of 5,7-dichloro-2,3-dihydroindol-1-amine (CID 151713616) is 5,7-dichloro-2,3-dihydroindol-1-amine.
What is the SMILES notation for 5,7-dichloro-2,3-dihydroindol-1-amine?
The canonical SMILES for 5,7-dichloro-2,3-dihydroindol-1-amine is NN1CCc2cc(Cl)cc(Cl)c21.
What is the InChIKey of 5,7-dichloro-2,3-dihydroindol-1-amine?
The InChIKey is RHBLKVNLVZTHNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8Cl2N2/c9-6-3-5-1-2-12(11)8(5)7(10)4-6/h3-4H,1-2,11H2.
What are the key properties of 5,7-dichloro-2,3-dihydroindol-1-amine?
5,7-dichloro-2,3-dihydroindol-1-amine has a molecular weight of 203.07 g/mol, XLogP of 2.23, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dichloro-2,3-dihydroindol-1-amine is sourced from PubChem (CID 151713616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).