C8H8Cl2N2 — CID 151713616
5,7-dichloro-2,3-dihydroindol-1-amine (PubChem CID 151713616) has the molecular formula C8H8Cl2N2 and a molecular weight of 203.07 g/mol. Its IUPAC name is 5,7-dichloro-2,3-dihydroindol-1-amine.
| Compound Name | 5,7-dichloro-2,3-dihydroindol-1-amine |
|---|---|
| PubChem CID | 151713616 |
| Molecular Formula | C8H8Cl2N2 |
| Molecular Weight | 203.07 g/mol |
| Exact Mass | 202.01 |
| IUPAC Name | 5,7-dichloro-2,3-dihydroindol-1-amine |
| SMILES | NN1CCc2cc(Cl)cc(Cl)c21 |
| InChI | InChI=1S/C8H8Cl2N2/c9-6-3-5-1-2-12(11)8(5)7(10)4-6/h3-4H,1-2,11H2 |
| InChIKey | RHBLKVNLVZTHNP-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.07 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|