C20H23NO5 — CID 151717163
(2-ethoxy-2-oxoethyl) 2-(naphthalen-1-yloxymethyl)pyrrolidine-1-carboxylate (PubChem CID 151717163) has the molecular formula C20H23NO5 and a molecular weight of 357.41 g/mol. Its IUPAC name is (2-ethoxy-2-oxoethyl) 2-(naphthalen-1-yloxymethyl)pyrrolidine-1-carboxylate.
| Compound Name | (2-ethoxy-2-oxoethyl) 2-(naphthalen-1-yloxymethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 151717163 |
| Molecular Formula | C20H23NO5 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | (2-ethoxy-2-oxoethyl) 2-(naphthalen-1-yloxymethyl)pyrrolidine-1-carboxylate |
| SMILES | CCOC(=O)COC(=O)N1CCCC1COc1cccc2ccccc12 |
| InChI | InChI=1S/C20H23NO5/c1-2-24-19(22)14-26-20(23)21-12-6-9-16(21)13-25-18-11-5-8-15-7-3-4-10-17(15)18/h3-5,7-8,10-11,16H,2,6,9,12-14H2,1H3 |
| InChIKey | RHULILDNXDMNRT-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |