C18H23NO4 — CID 89011951
4-oxo-4-[2-[(2-prop-1-en-2-ylphenoxy)methyl]pyrrolidin-1-yl]butanoic acid (PubChem CID 89011951) has the molecular formula C18H23NO4 and a molecular weight of 317.39 g/mol. Its IUPAC name is 4-oxo-4-[2-[(2-prop-1-en-2-ylphenoxy)methyl]pyrrolidin-1-yl]butanoic acid.
| Compound Name | 4-oxo-4-[2-[(2-prop-1-en-2-ylphenoxy)methyl]pyrrolidin-1-yl]butanoic acid |
|---|---|
| PubChem CID | 89011951 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 4-oxo-4-[2-[(2-prop-1-en-2-ylphenoxy)methyl]pyrrolidin-1-yl]butanoic acid |
| SMILES | C=C(C)c1ccccc1OCC1CCCN1C(=O)CCC(=O)O |
| InChI | InChI=1S/C18H23NO4/c1-13(2)15-7-3-4-8-16(15)23-12-14-6-5-11-19(14)17(20)9-10-18(21)22/h3-4,7-8,14H,1,5-6,9-12H2,2H3,(H,21,22) |
| InChIKey | UCSULBCNUULEDK-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |