C21H33NO2 — CID 126490475
2-[(2-tert-butylphenoxy)methyl]-1-[1-[(2-methylpropan-2-yl)oxy]ethenyl]pyrrolidine (PubChem CID 126490475) has the molecular formula C21H33NO2 and a molecular weight of 331.50 g/mol. Its IUPAC name is 2-[(2-tert-butylphenoxy)methyl]-1-[1-[(2-methylpropan-2-yl)oxy]ethenyl]pyrrolidine.
| Compound Name | 2-[(2-tert-butylphenoxy)methyl]-1-[1-[(2-methylpropan-2-yl)oxy]ethenyl]pyrrolidine |
|---|---|
| PubChem CID | 126490475 |
| Molecular Formula | C21H33NO2 |
| Molecular Weight | 331.50 g/mol |
| Exact Mass | 331.25 |
| IUPAC Name | 2-[(2-tert-butylphenoxy)methyl]-1-[1-[(2-methylpropan-2-yl)oxy]ethenyl]pyrrolidine |
| SMILES | C=C(OC(C)(C)C)N1CCCC1COc1ccccc1C(C)(C)C |
| InChI | InChI=1S/C21H33NO2/c1-16(24-21(5,6)7)22-14-10-11-17(22)15-23-19-13-9-8-12-18(19)20(2,3)4/h8-9,12-13,17H,1,10-11,14-15H2,2-7H3 |
| InChIKey | OOUCYZZAIYJZPM-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.50 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|