C17H22N2O4 — CID 15172351
ethyl 2-amino-3-[4-(2-ethoxy-2-oxoethyl)-1H-indol-3-yl]propanoate (PubChem CID 15172351) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is ethyl 2-amino-3-[4-(2-ethoxy-2-oxoethyl)-1H-indol-3-yl]propanoate.
| Compound Name | ethyl 2-amino-3-[4-(2-ethoxy-2-oxoethyl)-1H-indol-3-yl]propanoate |
|---|---|
| PubChem CID | 15172351 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | ethyl 2-amino-3-[4-(2-ethoxy-2-oxoethyl)-1H-indol-3-yl]propanoate |
| SMILES | CCOC(=O)Cc1cccc2[nH]cc(CC(N)C(=O)OCC)c12 |
| InChI | InChI=1S/C17H22N2O4/c1-3-22-15(20)9-11-6-5-7-14-16(11)12(10-19-14)8-13(18)17(21)23-4-2/h5-7,10,13,19H,3-4,8-9,18H2,1-2H3 |
| InChIKey | RYFAKUNZIONTTB-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 94.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |