C23H25NO7 — CID 151724918
2-(5-methylpyridine-3-carbonyl)-2-(2-phenylmethoxyacetyl)heptanedioic acid (PubChem CID 151724918) has the molecular formula C23H25NO7 and a molecular weight of 427.45 g/mol. Its IUPAC name is 2-(5-methylpyridine-3-carbonyl)-2-(2-phenylmethoxyacetyl)heptanedioic acid.
| Compound Name | 2-(5-methylpyridine-3-carbonyl)-2-(2-phenylmethoxyacetyl)heptanedioic acid |
|---|---|
| PubChem CID | 151724918 |
| Molecular Formula | C23H25NO7 |
| Molecular Weight | 427.45 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | 2-(5-methylpyridine-3-carbonyl)-2-(2-phenylmethoxyacetyl)heptanedioic acid |
| SMILES | Cc1cncc(C(=O)C(CCCCC(=O)O)(C(=O)O)C(=O)COCc2ccccc2)c1 |
| InChI | InChI=1S/C23H25NO7/c1-16-11-18(13-24-12-16)21(28)23(22(29)30,10-6-5-9-20(26)27)19(25)15-31-14-17-7-3-2-4-8-17/h2-4,7-8,11-13H,5-6,9-10,14-15H2,1H3,(H,26,27)(H,29,30) |
| InChIKey | RJJHURCTSBIZKO-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 130.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.45 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|