C14H15NO6 — CID 151928685
2-acetyl-2-(5-methylpyridine-3-carbonyl)pentanedioic acid (PubChem CID 151928685) has the molecular formula C14H15NO6 and a molecular weight of 293.27 g/mol. Its IUPAC name is 2-acetyl-2-(5-methylpyridine-3-carbonyl)pentanedioic acid.
| Compound Name | 2-acetyl-2-(5-methylpyridine-3-carbonyl)pentanedioic acid |
|---|---|
| PubChem CID | 151928685 |
| Molecular Formula | C14H15NO6 |
| Molecular Weight | 293.27 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 2-acetyl-2-(5-methylpyridine-3-carbonyl)pentanedioic acid |
| SMILES | CC(=O)C(CCC(=O)O)(C(=O)O)C(=O)c1cncc(C)c1 |
| InChI | InChI=1S/C14H15NO6/c1-8-5-10(7-15-6-8)12(19)14(9(2)16,13(20)21)4-3-11(17)18/h5-7H,3-4H2,1-2H3,(H,17,18)(H,20,21) |
| InChIKey | SYHWGOFOXCYBGX-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 121.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.27 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|