C20H27NO7 — CID 69307091
tert-butyl 2-[2-(2-methoxy-2-oxoethoxy)ethyl]-2-(5-methylpyridine-3-carbonyl)-3-oxobutanoate (PubChem CID 69307091) has the molecular formula C20H27NO7 and a molecular weight of 393.44 g/mol. Its IUPAC name is tert-butyl 2-[2-(2-methoxy-2-oxoethoxy)ethyl]-2-(5-methylpyridine-3-carbonyl)-3-oxobutanoate.
| Compound Name | tert-butyl 2-[2-(2-methoxy-2-oxoethoxy)ethyl]-2-(5-methylpyridine-3-carbonyl)-3-oxobutanoate |
|---|---|
| PubChem CID | 69307091 |
| Molecular Formula | C20H27NO7 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | tert-butyl 2-[2-(2-methoxy-2-oxoethoxy)ethyl]-2-(5-methylpyridine-3-carbonyl)-3-oxobutanoate |
| SMILES | COC(=O)COCCC(C(C)=O)(C(=O)OC(C)(C)C)C(=O)c1cncc(C)c1 |
| InChI | InChI=1S/C20H27NO7/c1-13-9-15(11-21-10-13)17(24)20(14(2)22,18(25)28-19(3,4)5)7-8-27-12-16(23)26-6/h9-11H,7-8,12H2,1-6H3 |
| InChIKey | SRFGRVBXSTWFDW-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 108.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|