C24H34BrNO7 — CID 68803719
1-O-tert-butyl 6-O-ethyl 2-(5-bromopyridine-3-carbonyl)-2-[2-(2-methylpropoxy)acetyl]hexanedioate (PubChem CID 68803719) has the molecular formula C24H34BrNO7 and a molecular weight of 528.44 g/mol. Its IUPAC name is 1-O-tert-butyl 6-O-ethyl 2-(5-bromopyridine-3-carbonyl)-2-[2-(2-methylpropoxy)acetyl]hexanedioate.
| Compound Name | 1-O-tert-butyl 6-O-ethyl 2-(5-bromopyridine-3-carbonyl)-2-[2-(2-methylpropoxy)acetyl]hexanedioate |
|---|---|
| PubChem CID | 68803719 |
| Molecular Formula | C24H34BrNO7 |
| Molecular Weight | 528.44 g/mol |
| Exact Mass | 527.15 |
| IUPAC Name | 1-O-tert-butyl 6-O-ethyl 2-(5-bromopyridine-3-carbonyl)-2-[2-(2-methylpropoxy)acetyl]hexanedioate |
| SMILES | CCOC(=O)CCCC(C(=O)COCC(C)C)(C(=O)OC(C)(C)C)C(=O)c1cncc(Br)c1 |
| InChI | InChI=1S/C24H34BrNO7/c1-7-32-20(28)9-8-10-24(22(30)33-23(4,5)6,19(27)15-31-14-16(2)3)21(29)17-11-18(25)13-26-12-17/h11-13,16H,7-10,14-15H2,1-6H3 |
| InChIKey | FVTPSLZESBAWNY-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 108.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.44 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|