C23H21F5NO4P — CID 151736748
[(2S)-1-[(2-methylphenyl)methoxy]-3-[2-(2,3,4,5,6-pentafluorophenyl)phenyl]propan-2-yl]oxyphosphonamidic acid (PubChem CID 151736748) has the molecular formula C23H21F5NO4P and a molecular weight of 501.39 g/mol. Its IUPAC name is [(2S)-1-[(2-methylphenyl)methoxy]-3-[2-(2,3,4,5,6-pentafluorophenyl)phenyl]propan-2-yl]oxyphosphonamidic acid.
| Compound Name | [(2S)-1-[(2-methylphenyl)methoxy]-3-[2-(2,3,4,5,6-pentafluorophenyl)phenyl]propan-2-yl]oxyphosphonamidic acid |
|---|---|
| PubChem CID | 151736748 |
| Molecular Formula | C23H21F5NO4P |
| Molecular Weight | 501.39 g/mol |
| Exact Mass | 501.11 |
| IUPAC Name | [(2S)-1-[(2-methylphenyl)methoxy]-3-[2-(2,3,4,5,6-pentafluorophenyl)phenyl]propan-2-yl]oxyphosphonamidic acid |
| SMILES | Cc1ccccc1COC[C@H](Cc1ccccc1-c1c(F)c(F)c(F)c(F)c1F)OP(N)(=O)O |
| InChI | InChI=1S/C23H21F5NO4P/c1-13-6-2-3-8-15(13)11-32-12-16(33-34(29,30)31)10-14-7-4-5-9-17(14)18-19(24)21(26)23(28)22(27)20(18)25/h2-9,16H,10-12H2,1H3,(H3,29,30,31)/t16-/m0/s1 |
| InChIKey | RLRRWEQNZJFDFL-INIZCTEOSA-N |
| XLogP | 5.56 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.39 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|