C24H23F5NO4P — CID 135174022
2-methyl-1-[(2-methylphenyl)methoxy]-N-[(2,3,4,5,6-pentafluorophenoxy)-phenoxyphosphoryl]propan-2-amine (PubChem CID 135174022) has the molecular formula C24H23F5NO4P and a molecular weight of 515.42 g/mol. Its IUPAC name is 2-methyl-1-[(2-methylphenyl)methoxy]-N-[(2,3,4,5,6-pentafluorophenoxy)-phenoxyphosphoryl]propan-2-amine.
| Compound Name | 2-methyl-1-[(2-methylphenyl)methoxy]-N-[(2,3,4,5,6-pentafluorophenoxy)-phenoxyphosphoryl]propan-2-amine |
|---|---|
| PubChem CID | 135174022 |
| Molecular Formula | C24H23F5NO4P |
| Molecular Weight | 515.42 g/mol |
| Exact Mass | 515.13 |
| IUPAC Name | 2-methyl-1-[(2-methylphenyl)methoxy]-N-[(2,3,4,5,6-pentafluorophenoxy)-phenoxyphosphoryl]propan-2-amine |
| SMILES | Cc1ccccc1COCC(C)(C)NP(=O)(Oc1ccccc1)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C24H23F5NO4P/c1-15-9-7-8-10-16(15)13-32-14-24(2,3)30-35(31,33-17-11-5-4-6-12-17)34-23-21(28)19(26)18(25)20(27)22(23)29/h4-12H,13-14H2,1-3H3,(H,30,31) |
| InChIKey | DJIVNDNUCLLKEL-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.42 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|