C29H36O6 — CID 151740350
2,3,4-trimethoxy-1-[5-(2,3,4-trimethoxy-1H-inden-1-yl)pentyl]-1H-indene (PubChem CID 151740350) has the molecular formula C29H36O6 and a molecular weight of 480.60 g/mol. Its IUPAC name is 2,3,4-trimethoxy-1-[5-(2,3,4-trimethoxy-1H-inden-1-yl)pentyl]-1H-indene.
| Compound Name | 2,3,4-trimethoxy-1-[5-(2,3,4-trimethoxy-1H-inden-1-yl)pentyl]-1H-indene |
|---|---|
| PubChem CID | 151740350 |
| Molecular Formula | C29H36O6 |
| Molecular Weight | 480.60 g/mol |
| Exact Mass | 480.25 |
| IUPAC Name | 2,3,4-trimethoxy-1-[5-(2,3,4-trimethoxy-1H-inden-1-yl)pentyl]-1H-indene |
| SMILES | COC1=C(OC)C(CCCCCC2C(OC)=C(OC)c3c(OC)cccc32)c2cccc(OC)c21 |
| InChI | InChI=1S/C29H36O6/c1-30-22-16-10-14-18-20(26(32-3)28(34-5)24(18)22)12-8-7-9-13-21-19-15-11-17-23(31-2)25(19)29(35-6)27(21)33-4/h10-11,14-17,20-21H,7-9,12-13H2,1-6H3 |
| InChIKey | RMJXIVWTYPUDCM-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.60 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|