C17H30O — CID 15174363
4,4-dimethylpentadec-1-en-6-yn-5-ol (PubChem CID 15174363) has the molecular formula C17H30O and a molecular weight of 250.43 g/mol. Its IUPAC name is 4,4-dimethylpentadec-1-en-6-yn-5-ol.
| Compound Name | 4,4-dimethylpentadec-1-en-6-yn-5-ol |
|---|---|
| PubChem CID | 15174363 |
| Molecular Formula | C17H30O |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.23 |
| IUPAC Name | 4,4-dimethylpentadec-1-en-6-yn-5-ol |
| SMILES | C=CCC(C)(C)C(O)C#CCCCCCCCC |
| InChI | InChI=1S/C17H30O/c1-5-7-8-9-10-11-12-13-14-16(18)17(3,4)15-6-2/h6,16,18H,2,5,7-12,15H2,1,3-4H3 |
| InChIKey | DDOYHTPKDHVLEL-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|