C17H20F3NO3 — CID 151750721
tert-butyl 2-methylidene-4-[(3,4,5-trifluorophenyl)methoxy]pyrrolidine-1-carboxylate (PubChem CID 151750721) has the molecular formula C17H20F3NO3 and a molecular weight of 343.35 g/mol. Its IUPAC name is tert-butyl 2-methylidene-4-[(3,4,5-trifluorophenyl)methoxy]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-methylidene-4-[(3,4,5-trifluorophenyl)methoxy]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 151750721 |
| Molecular Formula | C17H20F3NO3 |
| Molecular Weight | 343.35 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | tert-butyl 2-methylidene-4-[(3,4,5-trifluorophenyl)methoxy]pyrrolidine-1-carboxylate |
| SMILES | C=C1CC(OCc2cc(F)c(F)c(F)c2)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H20F3NO3/c1-10-5-12(8-21(10)16(22)24-17(2,3)4)23-9-11-6-13(18)15(20)14(19)7-11/h6-7,12H,1,5,8-9H2,2-4H3 |
| InChIKey | ROMDPNZSYBLIEN-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.35 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|