C18H20N4O3 — CID 15176146
2'-(1-methyl-5-nitroindol-3-yl)spiro[1-azabicyclo[2.2.2]octane-3,5'-4H-1,3-oxazole] (PubChem CID 15176146) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is 2'-(1-methyl-5-nitroindol-3-yl)spiro[1-azabicyclo[2.2.2]octane-3,5'-4H-1,3-oxazole].
| Compound Name | 2'-(1-methyl-5-nitroindol-3-yl)spiro[1-azabicyclo[2.2.2]octane-3,5'-4H-1,3-oxazole] |
|---|---|
| PubChem CID | 15176146 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 2'-(1-methyl-5-nitroindol-3-yl)spiro[1-azabicyclo[2.2.2]octane-3,5'-4H-1,3-oxazole] |
| SMILES | Cn1cc(C2=NCC3(CN4CCC3CC4)O2)c2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C18H20N4O3/c1-20-9-15(14-8-13(22(23)24)2-3-16(14)20)17-19-10-18(25-17)11-21-6-4-12(18)5-7-21/h2-3,8-9,12H,4-7,10-11H2,1H3 |
| InChIKey | GTZYQVOYWWPMME-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 72.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|