C18H22N4O — CID 15176147
1-methyl-3-spiro[1-azabicyclo[2.2.2]octane-3,5'-4H-1,3-oxazole]-2'-ylindol-5-amine (PubChem CID 15176147) has the molecular formula C18H22N4O and a molecular weight of 310.40 g/mol. Its IUPAC name is 1-methyl-3-spiro[1-azabicyclo[2.2.2]octane-3,5'-4H-1,3-oxazole]-2'-ylindol-5-amine.
| Compound Name | 1-methyl-3-spiro[1-azabicyclo[2.2.2]octane-3,5'-4H-1,3-oxazole]-2'-ylindol-5-amine |
|---|---|
| PubChem CID | 15176147 |
| Molecular Formula | C18H22N4O |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 1-methyl-3-spiro[1-azabicyclo[2.2.2]octane-3,5'-4H-1,3-oxazole]-2'-ylindol-5-amine |
| SMILES | Cn1cc(C2=NCC3(CN4CCC3CC4)O2)c2cc(N)ccc21 |
| InChI | InChI=1S/C18H22N4O/c1-21-9-15(14-8-13(19)2-3-16(14)21)17-20-10-18(23-17)11-22-6-4-12(18)5-7-22/h2-3,8-9,12H,4-7,10-11,19H2,1H3 |
| InChIKey | GDYCXIQSDLUQBN-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 55.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|