C22H31N4O7P — CID 151763740
(2S)-2-[[(2S)-2-[[acetamidomethoxy(hydroxy)phosphoryl]amino]-3-methylbutanoyl]amino]-3-[4-(1-methylpyrrol-2-yl)phenyl]propanoic acid (PubChem CID 151763740) has the molecular formula C22H31N4O7P and a molecular weight of 494.49 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[acetamidomethoxy(hydroxy)phosphoryl]amino]-3-methylbutanoyl]amino]-3-[4-(1-methylpyrrol-2-yl)phenyl]propanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[acetamidomethoxy(hydroxy)phosphoryl]amino]-3-methylbutanoyl]amino]-3-[4-(1-methylpyrrol-2-yl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 151763740 |
| Molecular Formula | C22H31N4O7P |
| Molecular Weight | 494.49 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[acetamidomethoxy(hydroxy)phosphoryl]amino]-3-methylbutanoyl]amino]-3-[4-(1-methylpyrrol-2-yl)phenyl]propanoic acid |
| SMILES | CC(=O)NCOP(=O)(O)N[C@H](C(=O)N[C@@H](Cc1ccc(-c2cccn2C)cc1)C(=O)O)C(C)C |
| InChI | InChI=1S/C22H31N4O7P/c1-14(2)20(25-34(31,32)33-13-23-15(3)27)21(28)24-18(22(29)30)12-16-7-9-17(10-8-16)19-6-5-11-26(19)4/h5-11,14,18,20H,12-13H2,1-4H3,(H,23,27)(H,24,28)(H,29,30)(H2,25,31,32)/t18-,20-/m0/s1 |
| InChIKey | RRCQOWROMOUQIY-ICSRJNTNSA-N |
| XLogP | 1.63 |
| TPSA | 158.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.49 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|