C21H28N3O8P — CID 150773688
(2S)-2-[[(2S)-2-[[acetamidomethoxy(hydroxy)phosphoryl]amino]-3-methylbutanoyl]amino]-3-[4-(furan-2-yl)phenyl]propanoic acid (PubChem CID 150773688) has the molecular formula C21H28N3O8P and a molecular weight of 481.44 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[acetamidomethoxy(hydroxy)phosphoryl]amino]-3-methylbutanoyl]amino]-3-[4-(furan-2-yl)phenyl]propanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-[[acetamidomethoxy(hydroxy)phosphoryl]amino]-3-methylbutanoyl]amino]-3-[4-(furan-2-yl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 150773688 |
| Molecular Formula | C21H28N3O8P |
| Molecular Weight | 481.44 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[acetamidomethoxy(hydroxy)phosphoryl]amino]-3-methylbutanoyl]amino]-3-[4-(furan-2-yl)phenyl]propanoic acid |
| SMILES | CC(=O)NCOP(=O)(O)N[C@H](C(=O)N[C@@H](Cc1ccc(-c2ccco2)cc1)C(=O)O)C(C)C |
| InChI | InChI=1S/C21H28N3O8P/c1-13(2)19(24-33(29,30)32-12-22-14(3)25)20(26)23-17(21(27)28)11-15-6-8-16(9-7-15)18-5-4-10-31-18/h4-10,13,17,19H,11-12H2,1-3H3,(H,22,25)(H,23,26)(H,27,28)(H2,24,29,30)/t17-,19-/m0/s1 |
| InChIKey | KAKCNIXRGZHQJB-HKUYNNGSSA-N |
| XLogP | 1.88 |
| TPSA | 167.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.44 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|