C24H29N2O7PS — CID 174366877
3-[4-(furan-2-yl)phenyl]-2-[[4-methyl-2-[phosphono(thiophen-2-ylmethyl)amino]pentanoyl]amino]propanoic acid (PubChem CID 174366877) has the molecular formula C24H29N2O7PS and a molecular weight of 520.54 g/mol. Its IUPAC name is 3-[4-(furan-2-yl)phenyl]-2-[[4-methyl-2-[phosphono(thiophen-2-ylmethyl)amino]pentanoyl]amino]propanoic acid.
| Compound Name | 3-[4-(furan-2-yl)phenyl]-2-[[4-methyl-2-[phosphono(thiophen-2-ylmethyl)amino]pentanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 174366877 |
| Molecular Formula | C24H29N2O7PS |
| Molecular Weight | 520.54 g/mol |
| Exact Mass | 520.14 |
| IUPAC Name | 3-[4-(furan-2-yl)phenyl]-2-[[4-methyl-2-[phosphono(thiophen-2-ylmethyl)amino]pentanoyl]amino]propanoic acid |
| SMILES | CC(C)CC(C(=O)NC(Cc1ccc(-c2ccco2)cc1)C(=O)O)N(Cc1cccs1)P(=O)(O)O |
| InChI | InChI=1S/C24H29N2O7PS/c1-16(2)13-21(26(34(30,31)32)15-19-5-4-12-35-19)23(27)25-20(24(28)29)14-17-7-9-18(10-8-17)22-6-3-11-33-22/h3-12,16,20-21H,13-15H2,1-2H3,(H,25,27)(H,28,29)(H2,30,31,32) |
| InChIKey | SNGZSXSHTFILHS-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 140.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.54 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|