C25H30N3O6PS — CID 174364155
2-[[4-methyl-2-[phosphono(thiophen-2-ylmethyl)amino]pentanoyl]amino]-3-(4-pyridin-3-ylphenyl)propanoic acid (PubChem CID 174364155) has the molecular formula C25H30N3O6PS and a molecular weight of 531.57 g/mol. Its IUPAC name is 2-[[4-methyl-2-[phosphono(thiophen-2-ylmethyl)amino]pentanoyl]amino]-3-(4-pyridin-3-ylphenyl)propanoic acid.
| Compound Name | 2-[[4-methyl-2-[phosphono(thiophen-2-ylmethyl)amino]pentanoyl]amino]-3-(4-pyridin-3-ylphenyl)propanoic acid |
|---|---|
| PubChem CID | 174364155 |
| Molecular Formula | C25H30N3O6PS |
| Molecular Weight | 531.57 g/mol |
| Exact Mass | 531.16 |
| IUPAC Name | 2-[[4-methyl-2-[phosphono(thiophen-2-ylmethyl)amino]pentanoyl]amino]-3-(4-pyridin-3-ylphenyl)propanoic acid |
| SMILES | CC(C)CC(C(=O)NC(Cc1ccc(-c2cccnc2)cc1)C(=O)O)N(Cc1cccs1)P(=O)(O)O |
| InChI | InChI=1S/C25H30N3O6PS/c1-17(2)13-23(28(35(32,33)34)16-21-6-4-12-36-21)24(29)27-22(25(30)31)14-18-7-9-19(10-8-18)20-5-3-11-26-15-20/h3-12,15,17,22-23H,13-14,16H2,1-2H3,(H,27,29)(H,30,31)(H2,32,33,34) |
| InChIKey | NAKGLVSOWLZUEX-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 140.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.57 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|