C22H30N3O8P — CID 174350997
2-[[2-[acetamidomethyl(phosphono)amino]-4-methylpentanoyl]amino]-3-[4-(furan-2-yl)phenyl]propanoic acid (PubChem CID 174350997) has the molecular formula C22H30N3O8P and a molecular weight of 495.47 g/mol. Its IUPAC name is 2-[[2-[acetamidomethyl(phosphono)amino]-4-methylpentanoyl]amino]-3-[4-(furan-2-yl)phenyl]propanoic acid.
| Compound Name | 2-[[2-[acetamidomethyl(phosphono)amino]-4-methylpentanoyl]amino]-3-[4-(furan-2-yl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 174350997 |
| Molecular Formula | C22H30N3O8P |
| Molecular Weight | 495.47 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | 2-[[2-[acetamidomethyl(phosphono)amino]-4-methylpentanoyl]amino]-3-[4-(furan-2-yl)phenyl]propanoic acid |
| SMILES | CC(=O)NCN(C(CC(C)C)C(=O)NC(Cc1ccc(-c2ccco2)cc1)C(=O)O)P(=O)(O)O |
| InChI | InChI=1S/C22H30N3O8P/c1-14(2)11-19(25(34(30,31)32)13-23-15(3)26)21(27)24-18(22(28)29)12-16-6-8-17(9-7-16)20-5-4-10-33-20/h4-10,14,18-19H,11-13H2,1-3H3,(H,23,26)(H,24,27)(H,28,29)(H2,30,31,32) |
| InChIKey | SJNXSNWCAHLHJH-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 169.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.47 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|