C13H16O4 — CID 151764995
(6,9-dimethyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-3-yl) prop-2-enoate (PubChem CID 151764995) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is (6,9-dimethyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-3-yl) prop-2-enoate.
| Compound Name | (6,9-dimethyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-3-yl) prop-2-enoate |
|---|---|
| PubChem CID | 151764995 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | (6,9-dimethyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-3-yl) prop-2-enoate |
| SMILES | C=CC(=O)OC12CC3CC1C(C)(C(=O)O2)C3C |
| InChI | InChI=1S/C13H16O4/c1-4-10(14)16-13-6-8-5-9(13)12(3,7(8)2)11(15)17-13/h4,7-9H,1,5-6H2,2-3H3 |
| InChIKey | RRJNXKPWXDLLQE-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|