C10H12O7 — CID 141084694
(2-hydroxy-3-methyl-5,8-dioxo-1,4-dioxocan-2-yl) prop-2-enoate (PubChem CID 141084694) has the molecular formula C10H12O7 and a molecular weight of 244.20 g/mol. Its IUPAC name is (2-hydroxy-3-methyl-5,8-dioxo-1,4-dioxocan-2-yl) prop-2-enoate.
| Compound Name | (2-hydroxy-3-methyl-5,8-dioxo-1,4-dioxocan-2-yl) prop-2-enoate |
|---|---|
| PubChem CID | 141084694 |
| Molecular Formula | C10H12O7 |
| Molecular Weight | 244.20 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | (2-hydroxy-3-methyl-5,8-dioxo-1,4-dioxocan-2-yl) prop-2-enoate |
| SMILES | C=CC(=O)OC1(O)OC(=O)CCC(=O)OC1C |
| InChI | InChI=1S/C10H12O7/c1-3-7(11)16-10(14)6(2)15-8(12)4-5-9(13)17-10/h3,6,14H,1,4-5H2,2H3 |
| InChIKey | QEYUIUSSOOAHJT-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.20 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|