C12H13ClO4 — CID 141244271
(9-chloro-2-methyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-6-yl) prop-2-enoate (PubChem CID 141244271) has the molecular formula C12H13ClO4 and a molecular weight of 256.69 g/mol. Its IUPAC name is (9-chloro-2-methyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-6-yl) prop-2-enoate.
| Compound Name | (9-chloro-2-methyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-6-yl) prop-2-enoate |
|---|---|
| PubChem CID | 141244271 |
| Molecular Formula | C12H13ClO4 |
| Molecular Weight | 256.69 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | (9-chloro-2-methyl-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-6-yl) prop-2-enoate |
| SMILES | C=CC(=O)OC12C(=O)OC3C(C)C(CC31)C2Cl |
| InChI | InChI=1S/C12H13ClO4/c1-3-8(14)17-12-7-4-6(10(12)13)5(2)9(7)16-11(12)15/h3,5-7,9-10H,1,4H2,2H3 |
| InChIKey | ZFZGDJUOEQELOQ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.69 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|