C12H12O4 — CID 130238825
(4-oxo-5-oxatetracyclo[4.4.0.02,8.02,10]decan-7-yl) prop-2-enoate (PubChem CID 130238825) has the molecular formula C12H12O4 and a molecular weight of 220.22 g/mol. Its IUPAC name is (4-oxo-5-oxatetracyclo[4.4.0.02,8.02,10]decan-7-yl) prop-2-enoate.
| Compound Name | (4-oxo-5-oxatetracyclo[4.4.0.02,8.02,10]decan-7-yl) prop-2-enoate |
|---|---|
| PubChem CID | 130238825 |
| Molecular Formula | C12H12O4 |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | (4-oxo-5-oxatetracyclo[4.4.0.02,8.02,10]decan-7-yl) prop-2-enoate |
| SMILES | C=CC(=O)OC1C2OC(=O)CC34C1CC3C24 |
| InChI | InChI=1S/C12H12O4/c1-2-7(13)15-10-6-3-5-9-11(10)16-8(14)4-12(5,6)9/h2,5-6,9-11H,1,3-4H2 |
| InChIKey | NFVXPPAXXCAIQE-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|