C12H21NO6S — CID 151769994
4-acetyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-sulfonic acid (PubChem CID 151769994) has the molecular formula C12H21NO6S and a molecular weight of 307.37 g/mol. Its IUPAC name is 4-acetyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-sulfonic acid.
| Compound Name | 4-acetyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-sulfonic acid |
|---|---|
| PubChem CID | 151769994 |
| Molecular Formula | C12H21NO6S |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 4-acetyl-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-2-sulfonic acid |
| SMILES | CC(=O)C1CCN(C(=O)OC(C)(C)C)C(S(=O)(=O)O)C1 |
| InChI | InChI=1S/C12H21NO6S/c1-8(14)9-5-6-13(10(7-9)20(16,17)18)11(15)19-12(2,3)4/h9-10H,5-7H2,1-4H3,(H,16,17,18) |
| InChIKey | RSJOEQBCCLFEME-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|